Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Chromium(III) chloride hexahydrate, 98%
CAS: 10060-12-5 Molecular Formula: Cl3CrH12O6 Molecular Weight (g/mol): 266.44 MDL Number: MFCD00149660 InChI Key: LJAOOBNHPFKCDR-UHFFFAOYSA-K Synonym: chromium iii chloride hexahydrate,chromic chloride hexahydrate,hexaaquachromium chloride,chromium trichloride hexahydrate,trichlorochromium hexahydrate,chromium chloride hexahydrate,hexaaquachromium iii chloride,chrom iii-chlorid,chromium 3+ chloride hexahydrate,chlorid chromity hexahydrat czech PubChem CID: 104957 ChEBI: CHEBI:53442 IUPAC Name: chromium(3+) hexahydrate trichloride SMILES: O.O.O.O.O.O.[Cl-].[Cl-].[Cl-].[Cr+3]
| PubChem CID | 104957 |
|---|---|
| CAS | 10060-12-5 |
| Molecular Weight (g/mol) | 266.44 |
| ChEBI | CHEBI:53442 |
| MDL Number | MFCD00149660 |
| SMILES | O.O.O.O.O.O.[Cl-].[Cl-].[Cl-].[Cr+3] |
| Synonym | chromium iii chloride hexahydrate,chromic chloride hexahydrate,hexaaquachromium chloride,chromium trichloride hexahydrate,trichlorochromium hexahydrate,chromium chloride hexahydrate,hexaaquachromium iii chloride,chrom iii-chlorid,chromium 3+ chloride hexahydrate,chlorid chromity hexahydrat czech |
| IUPAC Name | chromium(3+) hexahydrate trichloride |
| InChI Key | LJAOOBNHPFKCDR-UHFFFAOYSA-K |
| Molecular Formula | Cl3CrH12O6 |
Sodium hydrogen sulfate monohydrate, Reagent Grade
CAS: 10034-88-5 Molecular Formula: H3NaO5S Molecular Weight (g/mol): 138.07 MDL Number: MFCD00149210 InChI Key: JXHZRQHZVYDRGX-UHFFFAOYSA-M Synonym: sodium bisulfate monohydrate,sodium hydrogen sulfate monohydrate,unii-3kls9y77yj,sulfuric acid, monosodium salt, hydrate,3kls9y77yj,sodium hydrogensulfate hydrate,sulfuric acid, monosodium salt, monohydrate,sodium hydrate hydrogen sulfate,sodium hydrogen sulfate-1-hydrate,acmc-20ajox PubChem CID: 23673662 SMILES: O.[Na+].OS([O-])(=O)=O
| PubChem CID | 23673662 |
|---|---|
| CAS | 10034-88-5 |
| Molecular Weight (g/mol) | 138.07 |
| MDL Number | MFCD00149210 |
| SMILES | O.[Na+].OS([O-])(=O)=O |
| Synonym | sodium bisulfate monohydrate,sodium hydrogen sulfate monohydrate,unii-3kls9y77yj,sulfuric acid, monosodium salt, hydrate,3kls9y77yj,sodium hydrogensulfate hydrate,sulfuric acid, monosodium salt, monohydrate,sodium hydrate hydrogen sulfate,sodium hydrogen sulfate-1-hydrate,acmc-20ajox |
| InChI Key | JXHZRQHZVYDRGX-UHFFFAOYSA-M |
| Molecular Formula | H3NaO5S |
Sodium Chloride, ACS Reagent Grade, Ricca Chemical
CAS: 7647-14-5 Molecular Formula: ClNa Molecular Weight (g/mol): 58.44 MDL Number: MFCD00003477 InChI Key: FAPWRFPIFSIZLT-UHFFFAOYSA-M IUPAC Name: sodium chloride
| CAS | 7647-14-5 |
|---|---|
| Molecular Weight (g/mol) | 58.44 |
| MDL Number | MFCD00003477 |
| IUPAC Name | sodium chloride |
| InChI Key | FAPWRFPIFSIZLT-UHFFFAOYSA-M |
| Molecular Formula | ClNa |
Lanthanum(III) hydroxide, 99.95% (REO)
CAS: 14507-19-8 Molecular Formula: La(OH)3 MDL Number: MFCD00016160 Synonym: lanthanum hydroxide,la oh 3,lanthanum hydroxide van,lanthanum 3+ trihydroxide,acmc-1c707,lanthanum 3+ ion trihydroxide,lanthanum iii hydroxide trace rare earth metals basis 50g
| CAS | 14507-19-8 |
|---|---|
| MDL Number | MFCD00016160 |
| Synonym | lanthanum hydroxide,la oh 3,lanthanum hydroxide van,lanthanum 3+ trihydroxide,acmc-1c707,lanthanum 3+ ion trihydroxide,lanthanum iii hydroxide trace rare earth metals basis 50g |
| Molecular Formula | La(OH)3 |
Sodium borohydride, 98+%, powder
CAS: 16940-66-2 Molecular Formula: BH4Na Molecular Weight (g/mol): 37.83 MDL Number: MFCD00003518 InChI Key: YOQDYZUWIQVZSF-UHFFFAOYSA-N Synonym: Sodium tetrahydroborate,SBH IUPAC Name: sodium boranuide SMILES: [BH4-].[Na+]
| CAS | 16940-66-2 |
|---|---|
| Molecular Weight (g/mol) | 37.83 |
| MDL Number | MFCD00003518 |
| SMILES | [BH4-].[Na+] |
| Synonym | Sodium tetrahydroborate,SBH |
| IUPAC Name | sodium boranuide |
| InChI Key | YOQDYZUWIQVZSF-UHFFFAOYSA-N |
| Molecular Formula | BH4Na |
Potassium nitrite, ACS, 96.0% min
CAS: 7758-09-0 Molecular Formula: KNO2 Molecular Weight (g/mol): 85.10 MDL Number: MFCD00011408 InChI Key: BXNHTSHTPBPRFX-UHFFFAOYSA-M Synonym: potassium nitrite,nitrous acid, potassium salt,caswell no. 698,ccris 3959,potassium nitrite 1:1,epa pesticide chemical code 076203,nitrous acid, potassium salt 1:1,kaliumnitrit,acmc-1bi01,dsstox_cid_22320 PubChem CID: 516910 IUPAC Name: potassium;nitrite SMILES: [K+].[O-]N=O
| PubChem CID | 516910 |
|---|---|
| CAS | 7758-09-0 |
| Molecular Weight (g/mol) | 85.10 |
| MDL Number | MFCD00011408 |
| SMILES | [K+].[O-]N=O |
| Synonym | potassium nitrite,nitrous acid, potassium salt,caswell no. 698,ccris 3959,potassium nitrite 1:1,epa pesticide chemical code 076203,nitrous acid, potassium salt 1:1,kaliumnitrit,acmc-1bi01,dsstox_cid_22320 |
| IUPAC Name | potassium;nitrite |
| InChI Key | BXNHTSHTPBPRFX-UHFFFAOYSA-M |
| Molecular Formula | KNO2 |
Lithium chloride, ultra dry, 99.9% (metals basis)
CAS: 7447-41-8 Molecular Formula: ClLi Molecular Weight (g/mol): 42.39 MDL Number: MFCD00011078 InChI Key: KWGKDLIKAYFUFQ-UHFFFAOYSA-M Synonym: lithium chloride,lithium chloride licl,lithiumchloride,licl,chlorure de lithium,chlorku litu,chlorolithium,lithiumchlorid,chlorku litu polish,luthium chloride PubChem CID: 433294 ChEBI: CHEBI:48607 IUPAC Name: lithium(1+) chloride SMILES: [Li+].[Cl-]
| PubChem CID | 433294 |
|---|---|
| CAS | 7447-41-8 |
| Molecular Weight (g/mol) | 42.39 |
| ChEBI | CHEBI:48607 |
| MDL Number | MFCD00011078 |
| SMILES | [Li+].[Cl-] |
| Synonym | lithium chloride,lithium chloride licl,lithiumchloride,licl,chlorure de lithium,chlorku litu,chlorolithium,lithiumchlorid,chlorku litu polish,luthium chloride |
| IUPAC Name | lithium(1+) chloride |
| InChI Key | KWGKDLIKAYFUFQ-UHFFFAOYSA-M |
| Molecular Formula | ClLi |
Calcium sulfate dihydrate, ACS, 98.0-102.0%
CAS: 10101-41-4 Molecular Formula: CaH4O6S Molecular Weight (g/mol): 172.16 MDL Number: MFCD00149625 InChI Key: PASHVRUKOFIRIK-UHFFFAOYSA-L Synonym: calcium sulfate dihydrate,phosphogypsum,landplaster,annaline,compactrol,gips,gypsite,primoplast,satinite,gypsum stone PubChem CID: 24928 ChEBI: CHEBI:32583 IUPAC Name: calcium;sulfate;dihydrate SMILES: O.O.[Ca++].[O-]S([O-])(=O)=O
| PubChem CID | 24928 |
|---|---|
| CAS | 10101-41-4 |
| Molecular Weight (g/mol) | 172.16 |
| ChEBI | CHEBI:32583 |
| MDL Number | MFCD00149625 |
| SMILES | O.O.[Ca++].[O-]S([O-])(=O)=O |
| Synonym | calcium sulfate dihydrate,phosphogypsum,landplaster,annaline,compactrol,gips,gypsite,primoplast,satinite,gypsum stone |
| IUPAC Name | calcium;sulfate;dihydrate |
| InChI Key | PASHVRUKOFIRIK-UHFFFAOYSA-L |
| Molecular Formula | CaH4O6S |
Thermo Scientific Chemicals Potassium hydrogen carbonate, 99.5%, for biochemistry
CAS: 298-14-6 Molecular Formula: CHKO3 Molecular Weight (g/mol): 100.11 MDL Number: MFCD00011402 InChI Key: TYJJADVDDVDEDZ-UHFFFAOYSA-M Synonym: potassium bicarbonate,potassium hydrogen carbonate,potassium hydrogencarbonate,potassium acid carbonate,monopotassium carbonate,carbonic acid, monopotassium salt,unii-hm5z15lebn,potassiumbicarbonate,ccris 3510,khco3 PubChem CID: 516893 ChEBI: CHEBI:81862 SMILES: [K+].OC([O-])=O
| PubChem CID | 516893 |
|---|---|
| CAS | 298-14-6 |
| Molecular Weight (g/mol) | 100.11 |
| ChEBI | CHEBI:81862 |
| MDL Number | MFCD00011402 |
| SMILES | [K+].OC([O-])=O |
| Synonym | potassium bicarbonate,potassium hydrogen carbonate,potassium hydrogencarbonate,potassium acid carbonate,monopotassium carbonate,carbonic acid, monopotassium salt,unii-hm5z15lebn,potassiumbicarbonate,ccris 3510,khco3 |
| InChI Key | TYJJADVDDVDEDZ-UHFFFAOYSA-M |
| Molecular Formula | CHKO3 |
Sodium Nitrite, (USP/FCC), MP Biomedicals
CAS: 7632-00-0 Molecular Formula: NNaO2 Molecular Weight (g/mol): 69.00 MDL Number: MFCD00011118 InChI Key: LPXPTNMVRIOKMN-UHFFFAOYSA-M Synonym: sodium nitrite,nitrous acid, sodium salt,sodiumnitrite,erinitrit,filmerine,natrium nitrit,nitrito sodico,anti-rust,nitrite, sodium,diazotizing salts PubChem CID: 23668193 ChEBI: CHEBI:78870 IUPAC Name: sodium nitrite SMILES: [Na+].[O-]N=O
| PubChem CID | 23668193 |
|---|---|
| CAS | 7632-00-0 |
| Molecular Weight (g/mol) | 69.00 |
| ChEBI | CHEBI:78870 |
| MDL Number | MFCD00011118 |
| SMILES | [Na+].[O-]N=O |
| Synonym | sodium nitrite,nitrous acid, sodium salt,sodiumnitrite,erinitrit,filmerine,natrium nitrit,nitrito sodico,anti-rust,nitrite, sodium,diazotizing salts |
| IUPAC Name | sodium nitrite |
| InChI Key | LPXPTNMVRIOKMN-UHFFFAOYSA-M |
| Molecular Formula | NNaO2 |
Tungsten powder, APS <1 micron, 99.95% (metals basis), Thermo Scientific Chemicals
CAS: 7440-33-7 Molecular Formula: W Molecular Weight (g/mol): 183.84 MDL Number: MFCD00011461 InChI Key: WFKWXMTUELFFGS-UHFFFAOYSA-N Synonym: wolfram,ion,va,tungsten, elemental,wolframium,unii-v9306cxo6g,4+ ion,tungsten, soluble compounds,tungsten, insoluble compounds,powder PubChem CID: 23964 ChEBI: CHEBI:27998 IUPAC Name: tungsten SMILES: [W]
| PubChem CID | 23964 |
|---|---|
| CAS | 7440-33-7 |
| Molecular Weight (g/mol) | 183.84 |
| ChEBI | CHEBI:27998 |
| MDL Number | MFCD00011461 |
| SMILES | [W] |
| Synonym | wolfram,ion,va,tungsten, elemental,wolframium,unii-v9306cxo6g,4+ ion,tungsten, soluble compounds,tungsten, insoluble compounds,powder |
| IUPAC Name | tungsten |
| InChI Key | WFKWXMTUELFFGS-UHFFFAOYSA-N |
| Molecular Formula | W |
| Linear Formula | [CH3(CH2)3]4NF |
|---|---|
| Molecular Weight (g/mol) | 261.47 |
| ChEBI | CHEBI:51990 |
| Color | Brown to Green |
| Physical Form | Solution |
| SMILES | [F-].CCCC[N+](CCCC)(CCCC)CCCC |
| Merck Index | 15,9332 |
| InChI Key | FPGGTKZVZWFYPV-UHFFFAOYSA-M |
| Density | 0.8870g/mL |
| PubChem CID | 2724141 |
| Concentration or Composition (by Analyte or Components) | 0.90 to 1.10M |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Wear protective gloves/protective clothing/eye p |
| MDL Number | MFCD00011747 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Suspected of causing cancer. May cause respiratory irritation. Highly flammable liquid and vapor. May form explosive peroxides. May cause drowsiness or dizzines |
| Flash Point | −17°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | tetrabutylammonium fluoride,tbaf,tetrabutylazanium fluoride,tetrabutyl ammonium fluoride,tetra-n-butylammonium fluoride,tetrabutylamine, fluoride,n,n,n-tributylbutan-1-aminium fluoride,1-butanaminium, n,n,n-tributyl-, fluoride,n,n,n-tributyl-1-butanaminium fluoride,1-butanaminium, n,n,n-tributyl-, fluoride 1:1 |
| IUPAC Name | tetrabutylazanium;fluoride |
| Molecular Formula | C16H36FN |
| EINECS Number | 207-057-2 |
| Formula Weight | 261.46 |
| Specific Gravity | 0.887 |
Cesium chloride, 99+%, for analysis
CAS: 7647-17-8 Molecular Formula: ClCs Molecular Weight (g/mol): 168.36 MDL Number: MFCD00010955 InChI Key: AIYUHDOJVYHVIT-UHFFFAOYSA-M Synonym: cesium chloride,caesium chloride,cesium monochloride,cesium chloride cscl,dicesium dichloride,cscl,tricesium trichloride,unii-gnr9hml8ba,gnr9hml8ba,caesium 1+ ion chloride PubChem CID: 24293 ChEBI: CHEBI:63039 SMILES: [Cl-].[Cs+]
| PubChem CID | 24293 |
|---|---|
| CAS | 7647-17-8 |
| Molecular Weight (g/mol) | 168.36 |
| ChEBI | CHEBI:63039 |
| MDL Number | MFCD00010955 |
| SMILES | [Cl-].[Cs+] |
| Synonym | cesium chloride,caesium chloride,cesium monochloride,cesium chloride cscl,dicesium dichloride,cscl,tricesium trichloride,unii-gnr9hml8ba,gnr9hml8ba,caesium 1+ ion chloride |
| InChI Key | AIYUHDOJVYHVIT-UHFFFAOYSA-M |
| Molecular Formula | ClCs |
Silicon(IV) oxide, 99.0% (metals basis)
CAS: 7631-86-9 Molecular Formula: O2Si Molecular Weight (g/mol): 60.08 MDL Number: MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 SMILES: O=[Si]=O
| PubChem CID | 24261 |
|---|---|
| CAS | 7631-86-9 |
| Molecular Weight (g/mol) | 60.08 |
| ChEBI | CHEBI:30563 |
| MDL Number | MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |
Bismuth(III) oxide, 99.9%, (trace metal basis)
CAS: 1304-76-3 Molecular Formula: Bi2O3 Molecular Weight (g/mol): 465.96 MDL Number: MFCD00003462 InChI Key: TYIXMATWDRGMPF-UHFFFAOYSA-N Synonym: Bismuth trioxide IUPAC Name: dibismuth(3+) trioxidandiide SMILES: [O--].[O--].[O--].[Bi+3].[Bi+3]
| CAS | 1304-76-3 |
|---|---|
| Molecular Weight (g/mol) | 465.96 |
| MDL Number | MFCD00003462 |
| SMILES | [O--].[O--].[O--].[Bi+3].[Bi+3] |
| Synonym | Bismuth trioxide |
| IUPAC Name | dibismuth(3+) trioxidandiide |
| InChI Key | TYIXMATWDRGMPF-UHFFFAOYSA-N |
| Molecular Formula | Bi2O3 |